CymitQuimica logo

CAS 65190-36-5

:

1H-Pyrazole-3-carboxamide, 4-nitro-

Description:
1H-Pyrazole-3-carboxamide, 4-nitro- is an organic compound characterized by its pyrazole ring structure, which is a five-membered ring containing two nitrogen atoms. The presence of a carboxamide functional group at the 3-position and a nitro group at the 4-position contributes to its chemical reactivity and potential biological activity. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the carboxamide group. Its molecular structure suggests potential applications in pharmaceuticals, agrochemicals, or as a building block in organic synthesis. The nitro group can enhance the compound's electrophilic properties, making it a candidate for further chemical modifications. Additionally, the compound may exhibit specific biological activities, which can be explored in medicinal chemistry contexts. Safety data should be consulted for handling and usage, as compounds with nitro groups can sometimes be hazardous. Overall, 1H-Pyrazole-3-carboxamide, 4-nitro- is a compound of interest in various fields of chemical research.
Formula:C4H4N4O3
InChI:InChI=1S/C4H4N4O3/c5-4(9)3-2(8(10)11)1-6-7-3/h1H,(H2,5,9)(H,6,7)
InChI key:SVHOGXCJBBYKOT-UHFFFAOYSA-N
SMILES:C1=NNC(=C1[N+](=O)[O-])C(=O)N
Found 4 products.