CymitQuimica logo

CAS 652145-28-3

:

(5-{4-[4-(2,2-Diphenylvinyl)phenyl]-1,2,3,3A ,4,8B-hexahydro-cyclopenta[B]indol-7-ylmethylene}-4-oxo-2-thioxo-thiazolidin-3-yl)acetic acid

Description:
The chemical substance with the name "(5-{4-[4-(2,2-Diphenylvinyl)phenyl]-1,2,3,3A,4,8B-hexahydro-cyclopenta[B]indol-7-ylmethylene}-4-oxo-2-thioxo-thiazolidin-3-yl)acetic acid" and CAS number "652145-28-3" is a complex organic compound characterized by its multi-ring structure and functional groups. It features a thiazolidinone core, which is known for its biological activity, particularly in medicinal chemistry. The presence of a diphenylvinyl group suggests potential applications in organic electronics or as a fluorescent probe. The compound's structure indicates it may exhibit interesting pharmacological properties, possibly acting as an inhibitor or modulator in biological systems. Its thioxo and oxo functionalities contribute to its reactivity and potential interactions with biological targets. Additionally, the presence of multiple aromatic rings may enhance its stability and lipophilicity, influencing its solubility and bioavailability. Overall, this compound represents a unique scaffold that could be explored for various applications in drug discovery and materials science.
Formula:C37H30N2O3S2
InChI:InChI=1S/C37H30N2O3S2/c40-35(41)23-38-36(42)34(44-37(38)43)22-25-16-19-33-31(21-25)29-12-7-13-32(29)39(33)28-17-14-24(15-18-28)20-30(26-8-3-1-4-9-26)27-10-5-2-6-11-27/h1-6,8-11,14-22,29,32H,7,12-13,23H2,(H,40,41)/b34-22-
InChI key:XGMCROHUTRXETK-VQNDASPWSA-N
SMILES:C1CC2C(C1)N(C3=C2C=C(C=C3)/C=C\4/C(=O)N(C(=S)S4)CC(=O)O)C5=CC=C(C=C5)C=C(C6=CC=CC=C6)C7=CC=CC=C7
Found 3 products.