CymitQuimica logo

CAS 6525-45-7

:

ethyl 2-cyanobenzoate

Description:
Ethyl 2-cyanobenzoate, with the CAS number 6525-45-7, is an organic compound that belongs to the class of esters. It is characterized by the presence of a cyano group (-CN) and an ethyl ester functional group attached to a benzoate structure. This compound typically appears as a colorless to pale yellow liquid with a pleasant aromatic odor. Ethyl 2-cyanobenzoate is known for its moderate solubility in organic solvents, while being less soluble in water due to its hydrophobic nature. It exhibits a relatively stable structure under standard conditions but may undergo hydrolysis in the presence of strong acids or bases. The compound is often utilized in organic synthesis, particularly in the preparation of various pharmaceuticals and agrochemicals, owing to its reactivity and ability to participate in nucleophilic substitution reactions. Additionally, it may serve as an intermediate in the synthesis of other complex organic molecules. Safety precautions should be observed when handling this compound, as it may pose health risks if ingested or inhaled.
Formula:C10H9NO2
InChI:InChI=1/C10H9NO2/c1-2-13-10(12)9-6-4-3-5-8(9)7-11/h3-6H,2H2,1H3
InChI key:RQQAJOJDAZNFPF-UHFFFAOYSA-N
SMILES:CCOC(=O)c1ccccc1C#N
Found 4 products.