CymitQuimica logo

CAS 65295-58-1

:

Fluorophenoxybenzylbromide

Description:
Fluorophenoxybenzylbromide, identified by its CAS number 65295-58-1, is an organic compound characterized by the presence of a fluorophenyl group, a phenoxy group, and a bromobenzyl moiety. This compound typically exhibits a molecular structure that allows for various applications in organic synthesis and medicinal chemistry. Its fluorine atom can enhance lipophilicity and influence biological activity, making it a valuable building block in the development of pharmaceuticals. The bromine atom serves as a good leaving group, facilitating nucleophilic substitution reactions. Fluorophenoxybenzylbromide is likely to be a solid at room temperature, with properties such as solubility in organic solvents and stability under standard conditions. Its reactivity can be attributed to the presence of both the bromine and the phenoxy group, which can participate in further chemical transformations. Safety data should be consulted for handling, as halogenated compounds can pose health risks. Overall, this compound is of interest in research and development due to its unique structural features and potential applications.
Formula:C13H10BrFO
InChI:InChI=1S/C13H10BrFO/c14-9-10-2-1-3-13(8-10)16-12-6-4-11(15)5-7-12/h1-8H,9H2
InChI key:JGFSTQUUDSBQCO-UHFFFAOYSA-N
SMILES:C1=CC(=CC(=C1)OC2=CC=C(C=C2)F)CBr
Synonyms:
  • 3-(4-Fluorophenoxy)benzyl bromide
Found 4 products.