CymitQuimica logo

CAS 653-05-4

:

dipyrido[3,2-c:2',3'-e]pyridazine

Description:
Dipyrido[3,2-c:2',3'-e]pyridazine, with the CAS number 653-05-4, is a heterocyclic compound characterized by its fused pyridine rings, which contribute to its aromatic stability and unique electronic properties. This compound typically exhibits a planar structure, allowing for effective π-π stacking interactions, which can influence its behavior in various chemical environments. It is known for its potential applications in organic electronics, such as in the development of organic semiconductors and light-emitting devices, due to its ability to facilitate charge transport. Additionally, dipyrido[3,2-c:2',3'-e]pyridazine may exhibit interesting photophysical properties, making it a subject of interest in materials science and photochemistry. Its solubility and reactivity can vary depending on the substituents attached to the core structure, which can be tailored for specific applications. Overall, this compound represents a fascinating area of study within the field of organic chemistry, particularly in the context of advanced materials and molecular electronics.
Formula:C10H6N4
InChI:InChI=1/C10H6N4/c1-3-7-9(11-5-1)10-8(14-13-7)4-2-6-12-10/h1-6H
SMILES:c1cc2c(c3c(cccn3)nn2)nc1
Synonyms:
  • 1,5,6,10-Tetraazaphenanthrene
  • 4,5,9,10-Tetraazaphenanthrene
  • Dipyrido[3,2-c:2',3'-e]pyridazine
Found 1 products.