CymitQuimica logo

CAS 653-11-2

:

(2,3,5,6-Tetrafluorophenyl)hydrazine

Description:
(2,3,5,6-Tetrafluorophenyl)hydrazine is an organic compound characterized by the presence of a hydrazine functional group attached to a tetrafluorinated phenyl ring. Its molecular structure includes four fluorine atoms substituted on the aromatic ring, which significantly influences its chemical properties, such as increased electronegativity and altered reactivity compared to non-fluorinated analogs. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its physical state at room temperature. It is known for its potential applications in organic synthesis, particularly in the preparation of various pharmaceuticals and agrochemicals. The presence of fluorine atoms enhances its stability and can affect its solubility in organic solvents. Additionally, (2,3,5,6-Tetrafluorophenyl)hydrazine may exhibit specific reactivity patterns, such as forming diazo compounds or participating in coupling reactions. As with many hydrazine derivatives, it is essential to handle this compound with care due to potential toxicity and reactivity, particularly in the presence of strong oxidizing agents.
Formula:C6H4F4N2
InChI:InChI=1S/C6H4F4N2/c7-2-1-3(8)5(10)6(12-11)4(2)9/h1,12H,11H2
InChI key:InChIKey=TYMFVEOXNZYYTF-UHFFFAOYSA-N
SMILES:N(N)C1=C(F)C(F)=CC(F)=C1F
Synonyms:
  • NSC 97000
  • 2,3,5,6-Tetrafluorophenylhydrazine
  • Hydrazine, (2,3,5,6-tetrafluorophenyl)-
  • (2,3,5,6-Tetrafluorophenyl)hydrazine
Found 4 products.