CymitQuimica logo

CAS 65355-00-2

:

Octahydrobinaphtol

Description:
Octahydrobinaphtol, with the CAS number 65355-00-2, is a bicyclic organic compound that belongs to the class of polycyclic hydrocarbons. It is characterized by its structure, which consists of two fused cyclohexane rings, resulting in a saturated compound. This substance is typically colorless to pale yellow and is known for its relatively low volatility and moderate solubility in organic solvents. Octahydrobinaphtol exhibits interesting chemical properties, including the ability to undergo various reactions typical of alcohols, such as oxidation and esterification. It is often used as an intermediate in organic synthesis and may also serve as a building block in the production of more complex molecules. Additionally, due to its structural features, it may exhibit unique physical properties, such as specific melting and boiling points, which are influenced by its molecular interactions. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C20H22O2
InChI:InChI=1S/C20H22O2/c21-17-11-9-13-5-1-3-7-15(13)19(17)20-16-8-4-2-6-14(16)10-12-18(20)22/h9-12,21-22H,1-8H2
InChI key:UTXIFKBYNJRJPH-UHFFFAOYSA-N
SMILES:C1CCC2=C(C1)C=CC(=C2C3=C(C=CC4=C3CCCC4)O)O
Synonyms:
  • (S)-(-)-5,5,6,6,7,7,8,8-Octahydro-1,1-bi-2-naphtol
  • (S)-()-5,5,6,6,7,7,8,8-Octahydro(1,1binaphthalene)-2,2-diol
  • (S)-(-)-5,5,6,6,7,7,8,8-Octahydro-1,1-bi-2-naphthol
  • (S)-(-)-5,5',6,6',7,7',8,8'-Octahydro-1,1'-bi-2-naphthol
Found 7 products.