CymitQuimica logo

CAS 65367-98-8

:

Piperidine, 3-(4-methylphenyl)-, hydrochloride (1:1)

Description:
Piperidine, 3-(4-methylphenyl)-, hydrochloride (1:1), with the CAS number 65367-98-8, is a chemical compound that belongs to the class of piperidine derivatives. It features a piperidine ring, which is a six-membered saturated heterocyclic compound containing one nitrogen atom. The presence of the 4-methylphenyl group indicates that there is a methyl group attached to a phenyl ring at the para position relative to the nitrogen atom in the piperidine structure. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which enhances its utility in various applications, including pharmaceuticals. The compound may exhibit biological activity, making it of interest in medicinal chemistry. Its characteristics include a specific melting point, solubility profile, and potential reactivity, which are influenced by the functional groups present. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C12H17N·ClH
InChI:InChI=1S/C12H17N.ClH/c1-10-4-6-11(7-5-10)12-3-2-8-13-9-12;/h4-7,12-13H,2-3,8-9H2,1H3;1H
InChI key:InChIKey=JMZLKWZNRWZUSX-UHFFFAOYSA-N
SMILES:CC1=CC=C(C=C1)C2CCCNC2.Cl
Synonyms:
  • Piperidine, 3-(4-methylphenyl)-, hydrochloride
  • Piperidine, 3-(4-methylphenyl)-, hydrochloride (1:1)
Found 3 products.