CymitQuimica logo

CAS 65383-57-5

:

3-Ethoxy-4-methoxyphenol

Description:
3-Ethoxy-4-methoxyphenol, with the CAS number 65383-57-5, is an organic compound characterized by its aromatic structure, which includes a phenolic group. This compound features two ether functional groups: an ethoxy group (-OCH2CH3) and a methoxy group (-OCH3) attached to the benzene ring. The presence of these substituents influences its solubility, making it more soluble in organic solvents compared to water. 3-Ethoxy-4-methoxyphenol exhibits antioxidant properties, which can be beneficial in various applications, including cosmetics and pharmaceuticals. Additionally, its phenolic structure may contribute to its reactivity, allowing it to participate in various chemical reactions, such as electrophilic substitutions. The compound is typically synthesized through specific organic reactions involving phenolic precursors and alkylating agents. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken. Overall, 3-Ethoxy-4-methoxyphenol is a versatile compound with potential applications in multiple fields.
Formula:C9H12O3
InChI:InChI=1S/C9H12O3/c1-3-12-9-6-7(10)4-5-8(9)11-2/h4-6,10H,3H2,1-2H3
InChI key:InChIKey=YYXJGWHFSNJMDX-UHFFFAOYSA-N
SMILES:O(CC)C1=C(OC)C=CC(O)=C1
Synonyms:
  • Ai3-38508
  • Phenol, 3-ethoxy-4-methoxy-
  • Phenol, 3-ethoxy-4-methoxy-, monohydrate
  • 3-Ethoxy-4-methoxyphenol
Found 2 products.