CAS 654055-01-3
:Morin hydrate
Description:
Morin hydrate is a flavonoid compound known for its antioxidant properties and is derived from various plant sources, particularly from the Morus species (mulberries). It is characterized by its yellow crystalline appearance and is soluble in organic solvents like ethanol and methanol, but less soluble in water. The chemical structure of morin hydrate features multiple hydroxyl groups, which contribute to its ability to scavenge free radicals and exhibit potential health benefits, including anti-inflammatory and anticancer activities. The hydrate form indicates that it contains water molecules in its crystalline structure, which can influence its stability and solubility. Morin hydrate is often studied in the context of natural products chemistry and pharmacology, and it has applications in food science, cosmetics, and medicine due to its bioactive properties. Its CAS number, 654055-01-3, is a unique identifier that facilitates the cataloging and research of this compound in scientific literature and databases.
Formula:C15H10O7·xH2O
InChI:InChI=1S/C15H10O7.2H2O/c16-6-1-2-8(9(18)3-6)15-14(21)13(20)12-10(19)4-7(17)5-11(12)22-15;;/h1-5,16-19,21H;2*1H2
InChI key:AEVKYFNHIADTEI-UHFFFAOYSA-N
SMILES:C1=CC(=C(C=C1O)O)C2=C(C(=O)C3=C(C=C(C=C3O2)O)O)O.O.O
Synonyms:- 4H-1-Benzopyran-4-one,2-(2,4-dihydroxyphenyl)-3,5,7-trihydroxy-, hydrate (1:?)
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
Morin Hydrate
CAS:Formula:C15H10O7·xH2OPurity:>90.0%(HPLC)Color and Shape:Light yellow to Brown powder to crystalMolecular weight:302.24Morin hydrate
CAS:Formula:C15H10O7·xH2OPurity:≥ 95.0%Color and Shape:Yellow to brown powderMolecular weight:302.24 (anhydrous)Morin Hydrate
CAS:Controlled ProductApplications Morin Hydrate (cas# 654055-01-3) is a useful research chemical. Dyes and metabolites.
Formula:C15H10O7·H2OColor and Shape:NeatMolecular weight:320.251Morin hydrate
CAS:Morin hydrate is a flavonoid compound, which is a naturally occurring substance found primarily in the members of the Moraceae family, such as morus or mulberry and other fruits. It possesses significant antioxidant activity, which is achieved through its ability to scavenge free radicals and inhibit oxidative stress pathways. This mechanism of action is primarily due to its capacity to donate hydrogen atoms, thereby neutralizing unstable and reactive oxidative species.
Formula:C15H10O7·xH2OPurity:Min. 95%Color and Shape:PowderMolecular weight:302.24 g/molRef: 3D-FM35317
Discontinued product







