CymitQuimica logo

CAS 654059-12-8

:

ethyl 3-(2-chloropyridine-3-carbonyl)benzoate

Description:
Ethyl 3-(2-chloropyridine-3-carbonyl)benzoate is an organic compound characterized by its ester functional group, which is derived from benzoic acid and ethanol. The presence of a 2-chloropyridine moiety introduces both aromaticity and halogen substitution, influencing its reactivity and potential applications in medicinal chemistry. This compound typically exhibits moderate solubility in organic solvents, reflecting its hydrophobic nature due to the aromatic rings. Its molecular structure suggests potential for interactions such as hydrogen bonding and π-π stacking, which may be relevant in biological systems or material science. The chloropyridine group may also impart specific electronic properties, making it a candidate for various chemical reactions, including nucleophilic substitutions or coupling reactions. Additionally, the compound's unique structure may confer biological activity, making it of interest in drug discovery or agrochemical research. As with many organic compounds, safety data should be consulted to understand its handling and toxicity profiles.
Formula:C15H12ClNO3
InChI:InChI=1/C15H12ClNO3/c1-2-20-15(19)11-6-3-5-10(9-11)13(18)12-7-4-8-17-14(12)16/h3-9H,2H2,1H3
SMILES:CCOC(=O)c1cccc(c1)C(=O)c1cccnc1Cl
Found 1 products.