CAS 65411-49-6
:tetrabutylammonium methanesulfonate
Description:
Tetrabutylammonium methanesulfonate is a quaternary ammonium salt characterized by its tetrabutylammonium cation and methanesulfonate anion. It is typically a white to off-white solid that is soluble in polar solvents such as water and methanol, making it useful in various applications, including as a phase transfer catalyst in organic synthesis. The compound exhibits good thermal stability and is non-volatile, which enhances its utility in chemical processes. Its structure allows for the solubilization of ionic compounds in organic solvents, facilitating reactions that would otherwise be difficult. Additionally, tetrabutylammonium methanesulfonate is known for its low toxicity, making it a safer alternative in laboratory and industrial settings. It is often employed in electrochemistry and as a reagent in the synthesis of various organic compounds. Proper handling and storage are recommended to maintain its stability and effectiveness in applications.
Formula:C17H39NO3S
InChI:InChI=1/C16H36N.CH4O3S/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;1-5(2,3)4/h5-16H2,1-4H3;1H3,(H,2,3,4)/q+1;/p-1
InChI key:XHYYGJAYKIYARQ-UHFFFAOYSA-M
SMILES:CCCC[N+](CCCC)(CCCC)CCCC.CS(=O)(=O)[O-]
Synonyms:- N,N,N-tributylbutan-1-aminium methanesulfonate
- Tetrabutylammonium methanesulphonate
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
Tetrabutylammonium methanesulfonate
CAS:Formula:C17H39NO3SPurity:98%Color and Shape:SolidMolecular weight:337.5615Ref: IN-DA006R5V
100mg31.00€250mg31.00€1g50.00€5g117.00€10g182.00€25g346.00€100g1,120.00€500g3,992.00€Tetrabutylammonium methanesulphonate
CAS:Tetrabutylammonium methanesulphonateFormula:C17H39NO3SPurity:98%Molecular weight:337.56Tetrabutylammonium methanesulfonate
CAS:Tetrabutylammonium methanesulfonateFormula:C17H39NO3SPurity:98%Molecular weight:337.56Tetrabutylammonium methanesulfonate
CAS:Tetrabutylammonium methanesulfonate is an organic solvent that can be used as a phase transfer agent in the laboratory. Tetrabutylammonium methanesulfonate has been shown to denature proteins and other biomolecules at high temperatures, which is useful for analytical purposes. It is also capable of forming hydrogen bonds with anions and divalent hydrocarbons. This compound has been used in cancer therapy and functional groups have been shown to have a role in its ability to inhibit cholesterol esterase, leading to the prevention of LDL-cholesterol formation. Tetrabutylammonium methanesulfonate may also serve as a monomer in the synthesis of polymers or lipids due to its density properties and functional theory.Formula:C17H39NO3SPurity:Min. 95%Molecular weight:337.6 g/mol




