CymitQuimica logo

CAS 65420-68-0

:

Pentane, 1,5-bis(di-t-butylphosphino)-

Description:
Pentane, 1,5-bis(di-t-butylphosphino)-, also known by its CAS number 65420-68-0, is an organophosphorus compound characterized by the presence of two di-t-butylphosphino groups attached to a pentane backbone. This compound typically exhibits a high degree of steric hindrance due to the bulky t-butyl groups, which can influence its reactivity and interactions with other molecules. It is often utilized as a ligand in coordination chemistry, particularly in the formation of metal complexes, where it can stabilize low oxidation states of transition metals. The presence of phosphorus in its structure allows for unique electronic properties, making it valuable in catalysis and organic synthesis. Additionally, the compound is generally non-volatile and may have low solubility in water, but it is soluble in organic solvents. Its stability and reactivity can vary depending on the specific metal complexes it forms, making it a subject of interest in both academic and industrial research.
Formula:C21H46P2
InChI:InChI=1S/C21H46P2/c1-18(2,3)22(19(4,5)6)16-14-13-15-17-23(20(7,8)9)21(10,11)12/h13-17H2,1-12H3
InChI key:LZOGYLUPNPTZLL-UHFFFAOYSA-N
SMILES:CC(C)(C)P(CCCCCP(C(C)(C)C)C(C)(C)C)C(C)(C)C
Synonyms:
  • 1,5-Bis(Di-T-Butylphosphino)Pentane
  • Phosphine,1,5-pentanediylbis[bis(1,1-dimethylethyl)-
  • Di(tert-butyl)(5-[di(tert-butyl)phosphino]pentyl)phosphine
Found 2 products.