CymitQuimica logo

CAS 65427-77-2

:

2-[4-(4-nitro-2,1,3-benzoxadiazol-5-yl)piperazin-1-yl]ethanol

Description:
2-[4-(4-nitro-2,1,3-benzoxadiazol-5-yl)piperazin-1-yl]ethanol, with the CAS number 65427-77-2, is a chemical compound characterized by its complex structure, which includes a piperazine ring and a benzoxadiazole moiety. The presence of the nitro group on the benzoxadiazole contributes to its potential as a fluorescent probe or dye, making it useful in various applications, including biological imaging and sensing. The ethanol group provides solubility in polar solvents, enhancing its utility in biochemical contexts. This compound may exhibit specific interactions with biological targets due to its piperazine and nitrobenzoxadiazole components, which can influence its pharmacological properties. Additionally, the compound's stability, reactivity, and potential toxicity are important considerations for its use in research and industrial applications. Overall, its unique structural features make it a subject of interest in medicinal chemistry and materials science.
Formula:C12H15N5O4
InChI:InChI=1/C12H15N5O4/c18-8-7-15-3-5-16(6-4-15)10-2-1-9-11(14-21-13-9)12(10)17(19)20/h1-2,18H,3-8H2
SMILES:c1cc(c(c2c1non2)N(=O)=O)N1CCN(CC1)CCO
Synonyms:
  • 1-Piperazineethanol, 4-(4-nitro-2,1,3-benzoxadiazol-5-yl)-
Found 1 products.