CymitQuimica logo

CAS 654673-34-4

:

1-(2,4-difluorophenyl)-3-(4-fluorophenyl)propan-1-one

Description:
1-(2,4-Difluorophenyl)-3-(4-fluorophenyl)propan-1-one, with the CAS number 654673-34-4, is an organic compound characterized by its ketone functional group and the presence of multiple fluorine substituents on its aromatic rings. This compound features a propanone backbone, where the carbonyl group is attached to a propyl chain, and two distinct phenyl groups, one of which is substituted with two fluorine atoms at the 2 and 4 positions, while the other phenyl group has a single fluorine substituent at the para position. The presence of fluorine atoms typically enhances the compound's lipophilicity and may influence its biological activity, making it of interest in pharmaceutical research. Additionally, the compound's structure suggests potential applications in medicinal chemistry, particularly in the development of new therapeutic agents. Its physical properties, such as melting point, boiling point, and solubility, would depend on the specific interactions of the fluorinated groups and the overall molecular structure.
Formula:C15H11F3O
InChI:InChI=1/C15H11F3O/c16-11-4-1-10(2-5-11)3-8-15(19)13-7-6-12(17)9-14(13)18/h1-2,4-7,9H,3,8H2
SMILES:c1cc(ccc1CCC(=O)c1ccc(cc1F)F)F
Found 1 products.