CymitQuimica logo

CAS 655-42-5

:

2-(benzoylamino)-2-deoxyhexose

Description:
2-(Benzoylamino)-2-deoxyhexose, also known as 2-benzoylamino-2-deoxy-D-glucose, is a derivative of glucose where a benzoyl group is substituted at the amino position of the sugar. This compound typically exhibits characteristics common to amino sugars, including the presence of a hydroxyl group and an amine functional group, which contribute to its reactivity and solubility in polar solvents. The benzoyl group enhances its lipophilicity, potentially affecting its biological interactions and applications. This compound may participate in various chemical reactions, such as acylation and glycosylation, making it useful in synthetic organic chemistry and biochemistry. Its structural features allow it to engage in hydrogen bonding, influencing its physical properties like melting point and solubility. Additionally, 2-(benzoylamino)-2-deoxyhexose can serve as a building block in the synthesis of more complex molecules, including pharmaceuticals and glycosides. As with many sugar derivatives, it may also exhibit biological activity, which could be of interest in medicinal chemistry and research.
Formula:C13H17NO6
InChI:InChI=1/C13H17NO6/c15-6-9(11(18)12(19)10(17)7-16)14-13(20)8-4-2-1-3-5-8/h1-6,9-12,16-19H,7H2,(H,14,20)
InChI key:QCYHKZRHOGVACA-UHFFFAOYSA-N
SMILES:c1ccc(cc1)C(=N[C@@H]1[C@H]([C@@H]([C@@H](CO)OC1O)O)O)O
Synonyms:
  • D-glucopyranose, 2-(benzoylamino)-2-deoxy-
  • 2-Deoxy-2-[(phenylcarbonyl)amino]hexose
  • D-Glucose, 2-(benzoylamino)-2-deoxy-
  • N-(3,4,5,6-Tetrahydroxy-1-oxo-2-hexanyl)benzamide
  • 2-(Benzoylamino)-2-deoxyhexose
  • hexose, 2-(benzoylamino)-2-deoxy-
Found 5 products.