CymitQuimica logo

CAS 655249-87-9

:

1-Allyl-3-methylimidazolium bis((trifluoromethyl)sulfonyl)imide

Description:
1-Allyl-3-methylimidazolium bis((trifluoromethyl)sulfonyl)imide, with CAS number 655249-87-9, is an ionic liquid characterized by its unique combination of an imidazolium cation and a bis(trifluoromethyl)sulfonyl imide anion. This compound typically exhibits low volatility, high thermal stability, and excellent solvation properties, making it suitable for various applications in organic synthesis, electrochemistry, and as a solvent for ionic reactions. The presence of the trifluoromethyl groups contributes to its strong anion-cation interactions, enhancing its ionic conductivity. Additionally, the allyl group in the cation structure allows for potential polymerization and functionalization, which can be advantageous in materials science. Its properties can be influenced by factors such as temperature and the presence of other solvents or solutes, making it a versatile substance in both research and industrial applications. Overall, this ionic liquid represents a significant advancement in the field of green chemistry due to its potential to replace traditional organic solvents.
Formula:C9H11F6N3O4S2
InChI:InChI=1S/C7H11N2.C2F6NO4S2/c1-3-4-9-6-5-8(2)7-9;3-1(4,5)14(10,11)9-15(12,13)2(6,7)8/h3,5-7H,1,4H2,2H3;/q+1;-1
InChI key:DHMWATGUEVQTIY-UHFFFAOYSA-N
SMILES:C[N+]1=CN(C=C1)CC=C.C(F)(F)(F)S(=O)(=O)[N-]S(=O)(=O)C(F)(F)F
Found 6 products.