
CAS 655249-87-9
:1-Allyl-3-methylimidazolium bis((trifluoromethyl)sulfonyl)imide
Description:
1-Allyl-3-methylimidazolium bis((trifluoromethyl)sulfonyl)imide, with CAS number 655249-87-9, is an ionic liquid characterized by its unique combination of an imidazolium cation and a bis(trifluoromethyl)sulfonyl imide anion. This compound typically exhibits low volatility, high thermal stability, and excellent solvation properties, making it suitable for various applications in organic synthesis, electrochemistry, and as a solvent for ionic reactions. The presence of the trifluoromethyl groups contributes to its strong anion-cation interactions, enhancing its ionic conductivity. Additionally, the allyl group in the cation structure allows for potential polymerization and functionalization, which can be advantageous in materials science. Its properties can be influenced by factors such as temperature and the presence of other solvents or solutes, making it a versatile substance in both research and industrial applications. Overall, this ionic liquid represents a significant advancement in the field of green chemistry due to its potential to replace traditional organic solvents.
Formula:C9H11F6N3O4S2
InChI:InChI=1S/C7H11N2.C2F6NO4S2/c1-3-4-9-6-5-8(2)7-9;3-1(4,5)14(10,11)9-15(12,13)2(6,7)8/h3,5-7H,1,4H2,2H3;/q+1;-1
InChI key:DHMWATGUEVQTIY-UHFFFAOYSA-N
SMILES:C[N+]1=CN(C=C1)CC=C.C(F)(F)(F)S(=O)(=O)[N-]S(=O)(=O)C(F)(F)F
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
1-Allyl-3-methylimidazolium Bis(trifluoromethanesulfonyl)imide
CAS:Formula:C9H11F6N3O4S2Purity:>98.0%(HPLC)Color and Shape:Colorless to Light orange to Yellow clear liquidMolecular weight:403.311-Allyl-3-methylimidazolium bis((trifluoromethyl)sulfonyl)imide
CAS:Formula:C9H11F6N3O4S2Purity:98%Color and Shape:LiquidMolecular weight:403.32181-Allyl-3-Methylimidazolium Bis(Trifluoromethylsulfonyl)Imide
CAS:1-Allyl-3-Methylimidazolium Bis(Trifluoromethylsulfonyl)ImideFormula:C9H11F6N3O4S2Purity:>98%Molecular weight:403.321-Allyl-3-methylimidazolium bis((trifluoromethyl)sulfonyl)imide
CAS:1-Allyl-3-methylimidazolium bis((trifluoromethyl)sulfonyl)imideFormula:C9H11F6N3O4S2Purity:98%Molecular weight:403.321-Allyl-3-methylimidazolium bis((trifluoromethyl)sulfonyl)imide
CAS:Formula:C9H11F6N3O4S2Purity:98%Molecular weight:403.311-Allyl-3-methylimidazolium Bis(trifluoromethanesulfonyl)imide
CAS:1-Allyl-3-methylimidazolium Bis(trifluoromethanesulfonyl)imide (1AMT) is a dispersive inorganic compound that has been used as an analytical reagent. It is soluble in tetrahydrofuran and acetonitrile, but insoluble in water. 1AMT can be used to measure the viscosity of aqueous solutions. 1AMT is also used to study human serum and adsorbing properties on surfaces, which may be due to its ability to form hydrogen bonds with water molecules. 1AMT is a viologen that undergoes dehydrogenation when heated at 60°C for 10 minutes. The mechanism of this reaction is not clear, although it has been suggested that it involves an electron transfer from the methyl group and a proton from the sulfur atom. The electrochemical impedance spectroscopy (EIS) data show that 1AMT exhibits aFormula:C9H11F6N3O4S2Purity:Min. 95%Molecular weight:403.32 g/mol





