CymitQuimica logo

CAS 65550-77-8

:

2-Bromo-5-chloro-3-picoline

Description:
2-Bromo-5-chloro-3-picoline, with the CAS number 65550-77-8, is a heterocyclic organic compound belonging to the class of picolines, which are derivatives of pyridine. This compound features a pyridine ring substituted with both bromine and chlorine atoms, specifically at the 2 and 5 positions, respectively, and a methyl group at the 3 position. Its molecular structure contributes to its unique chemical properties, including moderate polarity and potential reactivity due to the presence of halogen substituents. 2-Bromo-5-chloro-3-picoline is typically used in organic synthesis and may serve as an intermediate in the production of pharmaceuticals or agrochemicals. The presence of halogens can influence its reactivity, making it a useful building block in various chemical reactions, such as nucleophilic substitutions. Additionally, it may exhibit biological activity, although specific applications and effects would depend on further research and context. Proper handling and safety measures are essential due to the potential hazards associated with halogenated compounds.
Formula:C6H5BrClN
InChI:InChI=1/C6H5BrClN/c1-4-2-5(8)3-9-6(4)7/h2-3H,1H3
InChI key:XEHWMXAUPXFOHZ-UHFFFAOYSA-N
SMILES:Cc1cc(cnc1Br)Cl
Synonyms:
  • 2-Bromo-3-methyl-5-chloropyridine
  • 2-Bromo-5-chloro-3-methylpyridine
  • Pyridine, 2-Bromo-5-Chloro-3-Methyl-
Found 6 products.