CAS 65556-30-1
:1,6-di-O-acetyl-2,3,4-tri-O-benzylhexopyranose
Description:
1,6-Di-O-acetyl-2,3,4-tri-O-benzylhexopyranose is a complex carbohydrate derivative characterized by its multiple acetyl and benzyl substituents. This compound features a hexopyranose structure, which is a six-membered cyclic form of a sugar, specifically a hexose. The presence of two acetyl groups at the 1 and 6 positions enhances its solubility and stability, while the three benzyl groups at the 2, 3, and 4 positions contribute to its hydrophobic characteristics and can influence its reactivity and interactions in various chemical environments. This compound is typically used in organic synthesis and carbohydrate chemistry, often serving as an intermediate in the preparation of more complex glycosides or other carbohydrate derivatives. Its unique structure allows for specific reactivity patterns, making it valuable in the development of pharmaceuticals and other bioactive compounds. Additionally, the presence of multiple functional groups provides opportunities for further chemical modifications, expanding its utility in synthetic applications.
Formula:C31H34O8
InChI:InChI=1/C31H34O8/c1-22(32)34-21-27-28(35-18-24-12-6-3-7-13-24)29(36-19-25-14-8-4-9-15-25)30(31(39-27)38-23(2)33)37-20-26-16-10-5-11-17-26/h3-17,27-31H,18-21H2,1-2H3
SMILES:CC(=O)OCC1C(C(C(C(OC(=O)C)O1)OCc1ccccc1)OCc1ccccc1)OCc1ccccc1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
1,6-Di-O-acetyl-2,3,4-tri-O-benzyl-α-D-mannopyranose
CAS:1,6-Di-O-acetyl-2,3,4-tri-O-benzyl-α-D-mannopyranoseFormula:C31H34O8Purity:>95.0%Molecular weight:534.611,6-Di-O-acetyl-2,3,4-tri-O-benzyl-α-D-mannopyranose
CAS:Formula:C31H34O8Purity:≥ 98.0%Color and Shape:White solidMolecular weight:534.601,6-Di-O-acetyl-2,3,4-tri-O-benzyl-α-D-mannopyranose
CAS:Formula:C31H34O8Purity:>95.0%(HPLC)Color and Shape:White to Almost white powder to crystalMolecular weight:534.611,6-Di-O-acetyl-2,3,4-tri-O-benzyl-α-D-mannopyranose
CAS:Controlled ProductApplications 1,6-Di-O-acetyl-2,3,4-tri-O-benzyl-α-D-mannopyranose (cas# 65556-30-1) is a compound useful in organic synthesis.
Formula:C31H34O8Color and Shape:NeatMolecular weight:534.61,6-Di-O-acetyl-2,3,4-tri-O-benzyl-α-D-mannopyranose
CAS:1,6-Di-O-acetyl-2,3,4-tri-O-benzyl-a-D-mannopyranose is a carbohydrate that has been synthetically prepared. The sugar was synthesized by the solid phase synthesis of an acetate derivative of 2,3,4-tri-O-benzylglucal and 1,6 diacetate benzil. The conformation of the sugar was determined from X-ray crystallography to be anomeric. The structure consists of a six membered ring with two oxygen atoms on opposite sides. This hexagonal ring is composed of four methylene groups and two oxygens. One oxygen atom is bonded to one carbon atom in the adjacent six membered ring with a single bond and the other oxygens are bonded to carbons in the adjacent six membered rings with double bonds. This results in three rings that are not fully interlocked as they have different degrees of freedomFormula:C31H34O8Purity:Min. 95%Molecular weight:534.6 g/mol




