CymitQuimica logo

CAS 65556-30-1

:

1,6-di-O-acetyl-2,3,4-tri-O-benzylhexopyranose

Description:
1,6-Di-O-acetyl-2,3,4-tri-O-benzylhexopyranose is a complex carbohydrate derivative characterized by its multiple acetyl and benzyl substituents. This compound features a hexopyranose structure, which is a six-membered cyclic form of a sugar, specifically a hexose. The presence of two acetyl groups at the 1 and 6 positions enhances its solubility and stability, while the three benzyl groups at the 2, 3, and 4 positions contribute to its hydrophobic characteristics and can influence its reactivity and interactions in various chemical environments. This compound is typically used in organic synthesis and carbohydrate chemistry, often serving as an intermediate in the preparation of more complex glycosides or other carbohydrate derivatives. Its unique structure allows for specific reactivity patterns, making it valuable in the development of pharmaceuticals and other bioactive compounds. Additionally, the presence of multiple functional groups provides opportunities for further chemical modifications, expanding its utility in synthetic applications.
Formula:C31H34O8
InChI:InChI=1/C31H34O8/c1-22(32)34-21-27-28(35-18-24-12-6-3-7-13-24)29(36-19-25-14-8-4-9-15-25)30(31(39-27)38-23(2)33)37-20-26-16-10-5-11-17-26/h3-17,27-31H,18-21H2,1-2H3
InChI key:IFCAMEQHKHEHBS-YOGXEWEVSA-N
SMILES:CC(=O)OCC1C(C(C(C(OC(=O)C)O1)OCc1ccccc1)OCc1ccccc1)OCc1ccccc1
Found 7 products.