CymitQuimica logo

CAS 656239-37-1

:

Benzamide,N-(tetrahydro-2H-pyran-4-yl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-

Description:
Benzamide, N-(tetrahydro-2H-pyran-4-yl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-, identified by CAS number 656239-37-1, is a chemical compound characterized by its unique structural features. It contains a benzamide moiety, which is a derivative of benzoic acid where the carboxylic acid group is replaced by an amide group. The presence of a tetrahydro-2H-pyran ring contributes to its cyclic structure, enhancing its potential for various chemical interactions. Additionally, the compound features a boron-containing dioxaborolane group, which is known for its applications in organic synthesis and as a reagent in cross-coupling reactions. The tetramethyl substituents on the dioxaborolane enhance its stability and solubility in organic solvents. Overall, this compound may exhibit interesting biological and chemical properties, making it a candidate for further research in medicinal chemistry and materials science. Its specific reactivity and applications would depend on the functional groups and overall molecular architecture.
Formula:C18H26BNO4
InChI:InChI=1S/C18H26BNO4/c1-17(2)18(3,4)24-19(23-17)14-7-5-13(6-8-14)16(21)20-15-9-11-22-12-10-15/h5-8,15H,9-12H2,1-4H3,(H,20,21)
InChI key:AAMXFCZFHXOARW-UHFFFAOYSA-N
SMILES:B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)C(=O)NC3CCOCC3
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.