CymitQuimica logo

CAS 65642-94-6

:

Dibenzothiophene, 1-bromo-

Description:
Dibenzothiophene, 1-bromo- is an organic compound characterized by the presence of a dibenzothiophene core structure, which consists of two fused benzene rings and a thiophene ring, with a bromine atom substituted at the first position. This compound is typically a pale yellow to brown solid and is insoluble in water but soluble in organic solvents such as dichloromethane and acetone. It exhibits aromatic properties due to the conjugated pi-electron system, which contributes to its stability and reactivity. The presence of the bromine atom introduces a site for electrophilic substitution reactions, making it useful in various chemical syntheses. Dibenzothiophene derivatives are of interest in the field of organic chemistry and materials science, particularly in the development of organic semiconductors and as intermediates in the synthesis of more complex molecules. Additionally, compounds like dibenzothiophene, 1-bromo- may be studied for their environmental impact, especially in relation to their occurrence in fossil fuels and their potential role in pollution.
Formula:C12H7BrS
InChI:InChI=1S/C12H7BrS/c13-9-5-3-7-11-12(9)8-4-1-2-6-10(8)14-11/h1-7H
InChI key:JESBGFNZNSEZMR-UHFFFAOYSA-N
SMILES:C1=CC=C2C(=C1)C3=C(S2)C=CC=C3Br
Synonyms:
  • 1-Bromodibenzothiophene ISO 9001：2015 REACH
  • Dibenzothiophene, 1-bromo-
  • 1-Bromodibenzothiophene
  • 1-bromodibenzo[b,d]thiophene
Found 5 products.