CymitQuimica logo

CAS 657409-24-0

:

Carbamic acid, [(3-amino-4-fluorophenyl)methyl]-, 1,1-dimethylethylester

Description:
Carbamic acid, [(3-amino-4-fluorophenyl)methyl]-, 1,1-dimethylethyl ester, identified by CAS number 657409-24-0, is an organic compound characterized by its carbamate functional group. This compound features a 3-amino-4-fluorophenyl moiety, which contributes to its biological activity and potential pharmacological properties. The presence of the dimethylethyl group enhances its lipophilicity, potentially influencing its solubility and permeability in biological systems. The fluorine atom in the aromatic ring can modify the electronic properties of the molecule, potentially affecting its reactivity and interaction with biological targets. Carbamic acids and their derivatives are often studied for their roles in medicinal chemistry, particularly as enzyme inhibitors or in the development of agrochemicals. The stability of this compound can be influenced by environmental factors such as pH and temperature, and it may undergo hydrolysis to release the corresponding amine and carbon dioxide under certain conditions. Overall, this compound's unique structure suggests potential applications in various fields, including pharmaceuticals and biochemistry.
Formula:C12H17FN2O2
InChI:InChI=1S/C12H17FN2O2/c1-12(2,3)17-11(16)15-7-8-4-5-9(13)10(14)6-8/h4-6H,7,14H2,1-3H3,(H,15,16)
InChI key:ZESPVVPBNKPRRE-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=O)NCC1=CC(=C(C=C1)F)N
Found 4 products.