CymitQuimica logo

CAS 65796-00-1

:

4-(trifluoromethoxy)benzyl chloride

Description:
4-(Trifluoromethoxy)benzyl chloride, with the CAS number 65796-00-1, is an organic compound characterized by the presence of a benzyl group substituted with a trifluoromethoxy group and a chlorine atom. This compound typically appears as a colorless to pale yellow liquid or solid, depending on the temperature and purity. It is known for its reactivity due to the presence of the chlorine atom, which can participate in nucleophilic substitution reactions. The trifluoromethoxy group enhances the compound's lipophilicity and can influence its biological activity, making it of interest in medicinal chemistry and material science. Additionally, the trifluoromethoxy moiety can impart unique electronic properties, affecting the compound's stability and reactivity. Safety considerations include handling it in a well-ventilated area and using appropriate personal protective equipment, as it may be harmful if inhaled or ingested. Overall, 4-(trifluoromethoxy)benzyl chloride is a valuable intermediate in the synthesis of various pharmaceuticals and agrochemicals.
Formula:C6H5F3O2
InChI:InChI=1/C6H5F3O2/c7-6(8,9)5-2-1-4(3-10)11-5/h1-2,10H,3H2
InChI key:LBMKFQMJURUPKC-UHFFFAOYSA-N
SMILES:c1cc(C(F)(F)F)oc1CO
Synonyms:
  • 1-(Chloromethyl)-4-(trifluoromethoxy)benzene
  • 1-(Chloromethyl)-3-(Trifluoromethoxy)Benzene
  • [5-(Trifluoromethyl)Furan-2-Yl]Methanol
  • 4-Trifluoromethoxybenzyl Chloride
Found 5 products.