CymitQuimica logo

CAS 65920-15-2

:

4-chloro-2-hydroxybenzohydrazide

Description:
4-Chloro-2-hydroxybenzohydrazide, with the CAS number 65920-15-2, is an organic compound characterized by its hydrazide functional group attached to a chlorinated aromatic ring. This compound features a hydroxyl group (-OH) and a chlorine atom (Cl) on a benzene ring, which contributes to its chemical reactivity and potential applications. It typically appears as a solid and may exhibit moderate solubility in polar solvents due to the presence of the hydroxyl group. The compound is of interest in various fields, including pharmaceuticals and agrochemicals, due to its potential biological activity. Its structure allows for interactions with biological targets, making it a candidate for further research in medicinal chemistry. Additionally, the presence of both the chloro and hydroxy substituents can influence its reactivity, stability, and interaction with other chemical species. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C7H7ClN2O2
InChI:InChI=1/C7H7ClN2O2/c8-4-1-2-5(6(11)3-4)7(12)10-9/h1-3,11H,9H2,(H,10,12)
SMILES:c1cc(c(cc1Cl)O)C(=NN)O
Synonyms:
  • Benzoic Acid, 4-Chloro-2-Hydroxy-, Hydrazide
Found 1 products.