CymitQuimica logo

CAS 66033-76-9

:

1,2-Benzisoxazole, 5-bromo-3-methyl-

Description:
1,2-Benzisoxazole, 5-bromo-3-methyl- is a heterocyclic organic compound characterized by its fused benzene and isoxazole rings. The presence of a bromine atom at the 5-position and a methyl group at the 3-position contributes to its unique chemical properties. This compound typically exhibits moderate solubility in organic solvents and may have limited solubility in water due to its hydrophobic aromatic structure. It is often utilized in medicinal chemistry and material science due to its potential biological activity and ability to participate in various chemical reactions, such as electrophilic substitutions and nucleophilic additions. The bromine substituent can enhance the compound's reactivity and influence its interaction with biological targets. Additionally, 1,2-benzisoxazoles are known for their applications in the development of pharmaceuticals, agrochemicals, and dyes, making them significant in both industrial and research settings. Safety and handling precautions should be observed, as with many halogenated compounds, due to potential toxicity and environmental impact.
Formula:C8H6BrNO
InChI:InChI=1S/C8H6BrNO/c1-5-7-4-6(9)2-3-8(7)11-10-5/h2-4H,1H3
InChI key:ITZVIXFFWVROPH-UHFFFAOYSA-N
SMILES:CC1=NOC2=C1C=C(C=C2)Br
Found 5 products.