CAS 66063-15-8: 4-Chloro-N-cyclopentylbenzenemethanamine
Description:4-Chloro-N-cyclopentylbenzenemethanamine, with the CAS number 66063-15-8, is an organic compound characterized by its structural features, which include a chlorinated aromatic ring and a cyclopentyl group attached to a methanamine moiety. This compound typically exhibits properties associated with amines, such as basicity and the ability to form hydrogen bonds, which can influence its solubility in various solvents. The presence of the chlorine atom introduces electronegative characteristics, potentially affecting the compound's reactivity and interaction with biological systems. Additionally, the cyclopentyl group contributes to the compound's hydrophobic nature, which may impact its pharmacokinetic properties if considered for medicinal applications. The compound's molecular structure suggests potential uses in organic synthesis or as an intermediate in the production of more complex molecules. However, specific safety and handling guidelines should be followed, as with any chemical substance, due to the potential for toxicity or environmental impact.
Formula:C12H16ClN
InChI:InChI=1S/C12H16ClN/c13-11-7-5-10(6-8-11)9-14-12-3-1-2-4-12/h5-8,12,14H,1-4,9H2
InChI key:InChIKey=XIXHUNCZQIRQOG-UHFFFAOYSA-N
SMILES:ClC1=CC=C(C=C1)CNC2CCCC2
- Synonyms:
- 4-Chloro-N-cyclopentylbenzenemethanamine
- Benzenemethanamine, 4-chloro-N-cyclopentyl-
- N-(4-Chlorobenzyl)-N-cyclopentylamine
- N-(4-chlorobenzyl)cyclopentanamine
- p-Chloro-N-cyclopentylbenzylamine
- 4-Chloro-N-cyclopentylbenzylamine

4-chloro-N-cyclopentylbenzylamine
Ref: IN-DA00FM42
1g | 72.00 € | ||
5g | 198.00 € | ||
250mg | 34.00 € |

Pencycuron-PB-amine
Controlled ProductRef: 04-C15921000
25mg | 141.00 € |

Ref: 10-F689918
1g | To inquire | ||
5g | To inquire | ||
250mg | To inquire |

N-[(4-Chlorophenyl)methyl]cyclopentanamine
Controlled ProductRef: TR-N300096
1g | 166.00 € | ||
250mg | 97.00 € | ||
500mg | 136.00 € |