CymitQuimica logo

CAS 66076-38-8

:

N-T-boc-phe-tyr-dicyclohexylammonium

Description:
N-T-boc-phe-tyr-dicyclohexylammonium, with the CAS number 66076-38-8, is a chemical compound that features a tert-butyloxycarbonyl (Boc) protecting group attached to the phenylalanine (Phe) and tyrosine (Tyr) amino acids. This compound is typically used in peptide synthesis and other organic chemistry applications due to its ability to protect amino groups during reactions. The dicyclohexylammonium component suggests that it may exhibit properties associated with quaternary ammonium compounds, such as solubility in organic solvents and potential ionic interactions. The presence of the Boc group allows for selective deprotection under mild acidic conditions, facilitating the synthesis of complex peptides. Additionally, the bulky dicyclohexylammonium moiety can influence the compound's solubility and stability, making it useful in various chemical and pharmaceutical applications. Overall, N-T-boc-phe-tyr-dicyclohexylammonium is characterized by its protective group functionality, structural complexity, and utility in synthetic organic chemistry.
Formula:C23H28N2O6·C12H23N
InChI:InChI=1S/C23H28N2O6/c1-23(2,3)31-22(30)25-18(13-15-7-5-4-6-8-15)20(27)24-19(21(28)29)14-16-9-11-17(26)12-10-16/h4-12,18-19,26H,13-14H2,1-3H3,(H,24,27)(H,25,30)(H,28,29)/t18-,19-/m0/s1
InChI key:SIRXGPIISDLXFD-OALUTQOASA-N
SMILES:CC(C)(C)OC(=O)N[C@@H](CC1=CC=CC=C1)C(=O)N[C@@H](CC2=CC=C(C=C2)O)C(=O)O
Found 3 products.