CAS 6608-47-5
:N-(3-methoxyphenyl)-2-(morpholin-4-yl)-2-oxoacetamide
Description:
N-(3-methoxyphenyl)-2-(morpholin-4-yl)-2-oxoacetamide, with the CAS number 6608-47-5, is a chemical compound characterized by its unique structural features. It contains a methoxy-substituted phenyl group and a morpholine ring, which contribute to its potential biological activity. The presence of the acetamide functional group indicates that it may exhibit properties typical of amides, such as hydrogen bonding capabilities. This compound is often studied for its pharmacological properties, particularly in the context of medicinal chemistry, where modifications to the phenyl and morpholine moieties can influence its efficacy and selectivity as a drug candidate. Its molecular structure suggests potential interactions with biological targets, making it of interest in drug development. Additionally, the compound's solubility, stability, and reactivity can vary based on environmental conditions, which are important factors to consider in both laboratory and therapeutic applications. Overall, N-(3-methoxyphenyl)-2-(morpholin-4-yl)-2-oxoacetamide represents a class of compounds that may have significant implications in pharmaceutical research.
Formula:C13H16N2O4
InChI:InChI=1/C13H16N2O4/c1-18-11-4-2-3-10(9-11)14-12(16)13(17)15-5-7-19-8-6-15/h2-4,9H,5-8H2,1H3,(H,14,16)
SMILES:COc1cccc(c1)NC(=O)C(=O)N1CCOCC1
Synonyms:- N-(3-methoxyphenyl)-2-morpholin-4-yl-2-oxo-acetamide
- Ethenesulfonyl chloride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Ethenesulfonyl chloride
CAS:Formula:C2H3ClO2SPurity:95%Color and Shape:LiquidMolecular weight:126.5620Ref: IN-DA0038JU
25gTo inquire50gTo inquire50mg27.00€100mg31.00€250mg52.00€1g92.00€5g225.00€10g541.00€Ethenesulfonyl chloride
CAS:Ethenesulfonyl chloridePurity:95%Color and Shape:LiquidMolecular weight:126.56g/molEthenesulfonyl Chloride
CAS:Formula:C2H3ClO2SPurity:>97.0%(GC)(T)Color and Shape:Colorless to Light yellow clear liquidMolecular weight:126.55ETHENESULFONYL CHLORIDE
CAS:Formula:C2H3ClO2SPurity:95%Color and Shape:Liquid, OilMolecular weight:126.55Ethenesulfonyl chloride
CAS:Controlled ProductApplications Ethenesulfonyl chloride is a useful reactant for the preparation of oral quinoline-based ALDH1A1 inhibitors as potential antitumor agents.
References Yang, SM., et al.: J. Med. Chem., 61, 4883-4903 (2018);Formula:C2H3ClO2SColor and Shape:ColourlessMolecular weight:126.56Ethenesulfonyl chloride
CAS:Ethenesulfonyl chloride is a chemical that is used as an inhibitor of amine oxidases in the treatment of inflammatory and autoimmune diseases. It also inhibits the formation of reactive oxygen species by inhibiting intracellular amines, which are required for the generation of reactive oxygen species. Ethenesulfonyl chloride is a nucleophile that reacts with protons from water to form a hydroxyl group, which can then react with chlorine atoms to form hydrogen chloride. This reaction results in the release of heat, which may be useful for killing bacteria or other microbes.Formula:C2H3ClO2SPurity:Min. 95%Molecular weight:126.56 g/mol





