CAS 6608-47-5

N-(3-methoxyphenyl)-2-(morpholin-4-yl)-2-oxoacetamide

Description:

N-(3-methoxyphenyl)-2-(morpholin-4-yl)-2-oxoacetamide, with the CAS number 6608-47-5, is a chemical compound characterized by its unique structural features. It contains a methoxy-substituted phenyl group and a morpholine ring, which contribute to its potential biological activity. The presence of the acetamide functional group indicates that it may exhibit properties typical of amides, such as hydrogen bonding capabilities. This compound is often studied for its pharmacological properties, particularly in the context of medicinal chemistry, where modifications to the phenyl and morpholine moieties can influence its efficacy and selectivity as a drug candidate. Its molecular structure suggests potential interactions with biological targets, making it of interest in drug development. Additionally, the compound's solubility, stability, and reactivity can vary based on environmental conditions, which are important factors to consider in both laboratory and therapeutic applications. Overall, N-(3-methoxyphenyl)-2-(morpholin-4-yl)-2-oxoacetamide represents a class of compounds that may have significant implications in pharmaceutical research.

Formula: C₁₃H₁₆N₂O₄

InChI: InChI=1/C13H16N2O4/c1-18-11-4-2-3-10(9-11)14-12(16)13(17)15-5-7-19-8-6-15/h2-4,9H,5-8H2,1H3,(H,14,16)

SMILES: COc1cccc(c1)NC(=O)C(=O)N1CCOCC1

Synonyms:

• N-(3-methoxyphenyl)-2-morpholin-4-yl-2-oxo-acetamide
• Ethenesulfonyl chloride

Ethenesulfonyl chloride

CAS: 6608-47-5

Formula: C₂H₃ClO₂S

Purity: 95%

Color and Shape: Liquid

Molecular weight: 126.5620

Ref: IN-DA0038JU

Ethenesulfonyl chloride

CAS: 6608-47-5

Ethenesulfonyl chloride

Formula: C₂H₃ClO₂S

Purity: 95%

Molecular weight: 126.56

Ref: IN-DG223441

Ethenesulfonyl chloride

CAS: 6608-47-5

Ethenesulfonyl chloride

Formula: C₂H₃ClO₂S

Purity: 95%

Color and Shape: Liquid

Molecular weight: 126.56201

Ref: 54-OR939136

Ethenesulfonyl Chloride

CAS: 6608-47-5

Formula: C₂H₃ClO₂S

Purity: >97.0%(GC)(T)

Color and Shape: Colorless to Light yellow clear liquid

Molecular weight: 126.55

Ref: 3B-E1665

Ethenesulfonyl chloride

Controlled Product

CAS: 6608-47-5

Applications Ethenesulfonyl chloride is a useful reactant for the preparation of oral quinoline-based ALDH1A1 inhibitors as potential antitumor agents.
References Yang, SM., et al.: J. Med. Chem., 61, 4883-4903 (2018);

Formula: C₂H₃ClO₂S

Color and Shape: Neat

Molecular weight: 126.56

Ref: TR-E677750

ETHENESULFONYL CHLORIDE

CAS: 6608-47-5

Formula: C₂H₃ClO₂S

Purity: 95%

Color and Shape: Liquid, Oil

Molecular weight: 126.55

Ref: 10-F533434

Ethenesulfonyl chloride

CAS: 6608-47-5

Ethenesulfonyl chloride is a chemical that is used as an inhibitor of amine oxidases in the treatment of inflammatory and autoimmune diseases. It also inhibits the formation of reactive oxygen species by inhibiting intracellular amines, which are required for the generation of reactive oxygen species. Ethenesulfonyl chloride is a nucleophile that reacts with protons from water to form a hydroxyl group, which can then react with chlorine atoms to form hydrogen chloride. This reaction results in the release of heat, which may be useful for killing bacteria or other microbes.

Formula: C₂H₃ClO₂S

Purity: Min. 95%

Molecular weight: 126.56 g/mol

Ref: 3D-FE157085