CymitQuimica logo

CAS 660845-30-7

:

1H-Pyrazole-4-carboxaldehyde, 5-chloro-3-(difluoromethyl)-1-methyl-

Description:
1H-Pyrazole-4-carboxaldehyde, 5-chloro-3-(difluoromethyl)-1-methyl- is an organic compound characterized by its pyrazole ring structure, which is a five-membered ring containing two adjacent nitrogen atoms. This compound features a carboxaldehyde functional group, contributing to its reactivity and potential applications in organic synthesis. The presence of a chloro substituent and a difluoromethyl group enhances its chemical properties, making it of interest in medicinal chemistry and agrochemical research. The difluoromethyl group can influence the compound's lipophilicity and biological activity, while the chloro group may participate in further chemical transformations. As a pyrazole derivative, it may exhibit various biological activities, including potential anti-inflammatory or antimicrobial properties. The compound's molecular structure and functional groups suggest it could be utilized in the development of pharmaceuticals or as an intermediate in the synthesis of more complex molecules. Proper handling and storage are essential due to its reactive aldehyde group, which can participate in condensation reactions and other chemical processes.
Formula:C6H5ClF2N2O
InChI:InChI=1S/C6H5ClF2N2O/c1-11-5(7)3(2-12)4(10-11)6(8)9/h2,6H,1H3
InChI key:NMYPMEAFQUDCSC-UHFFFAOYSA-N
SMILES:CN1C(=C(C(=N1)C(F)F)C=O)Cl
Synonyms:
  • 5-Chloro-3-difluoromethyl-1-methyl-1H-pyrazole-4-carbaldehyde
  • 5-Chloro-3-(difluoromethyl)-1-methyl-1H-pyrazole-4-carboxaldehyde
Found 5 products.