CAS 66148-18-3
:2,3,4,6-tetradeuterio-5-pyrrolidin-2-yl-pyridine
Description:
2,3,4,6-Tetradeuterio-5-pyrrolidin-2-yl-pyridine is a deuterated derivative of pyridine, a heterocyclic aromatic compound. The presence of deuterium, a stable isotope of hydrogen, in the molecule enhances its stability and alters its physical properties compared to its non-deuterated counterpart. This compound features a pyridine ring substituted with a pyrrolidine group, which introduces a five-membered nitrogen-containing ring, contributing to its unique chemical behavior. The deuterium substitution can affect the compound's reactivity, particularly in kinetic isotope effects, making it useful in studies involving reaction mechanisms and molecular dynamics. Additionally, the presence of multiple deuterium atoms can enhance the compound's solubility in certain solvents and influence its spectroscopic properties, such as NMR. This compound is primarily used in research settings, particularly in the fields of medicinal chemistry and pharmacology, where it may serve as a tracer or in the development of pharmaceuticals. Its specific applications and characteristics can vary based on the context of its use in scientific studies.
Formula:C9H8D4N2
InChI:InChI=1/C9H12N2/c1-3-8(7-10-5-1)9-4-2-6-11-9/h1,3,5,7,9,11H,2,4,6H2/i1D,3D,5D,7D
SMILES:c1(c(c(c(nc1[2H])[2H])C1CCCN1)[2H])[2H]
Synonyms:- 3-(Pyrrolidin-2-yl)(< sup> 2< /sup> H< sub> 4< /sub> )pyridine
- Pyridine-2,3,4,6-D< Sub> 4< /Sub> , 5-(2-Pyrrolidinyl)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
(+/-)-Nornicotine-2,4,5,6-d4(pyridine-d4)
CAS:Purity:98 atom % DColor and Shape:Colorless LiquidMolecular weight:152.23(R,S)-Nornicotine-d4
CAS:Controlled ProductStability Light Sensitive
Applications Labelled (RS)-Nornicotine (N757000). (RS)-Nornicotine is a tobacco alkaloid and the major Nicotine (N412420) metabolite in brain. Nornicotine appears to activate different nAChR subtypes, has a better pharmacokinetic profile, and produces less toxicity than Nicotine. Nornicotine shows a significant analgesic activity.
References Hecht, S., et al.: Carcinogenesis, 9, 875 (1988), Rivenson, A., et al.: Cancer Res., 48, 6912 (1988), Hoffmann, D., et al.: Chem. Res. Toxicol., 14, 767 (2001), Kool, J., et al.: J. Med. Chem., 49, 3287 (2006), Kool, J., et al.: Drug Metab. Dispos., 35, 640 (2007),Formula:C92H4H8N2Color and Shape:Colourless To Light YellowMolecular weight:152.23(R,S)-Nornicotine-d4 (100 ug/mL in Methanol)
CAS:Controlled ProductFormula:C92H4H8N2Color and Shape:Single SolutionMolecular weight:152.23


