CAS 66171-50-4
:Methyl 6-hydroxynicotinate
Description:
Methyl 6-hydroxynicotinate, with the CAS number 66171-50-4, is an organic compound derived from nicotinic acid, featuring a hydroxyl group at the 6-position and a methyl ester functional group. This compound is characterized by its aromatic structure, which includes a pyridine ring, contributing to its potential biological activity. Methyl 6-hydroxynicotinate is known for its solubility in organic solvents, making it useful in various chemical applications, including as a precursor in the synthesis of pharmaceuticals and agrochemicals. The presence of the hydroxyl group enhances its reactivity, allowing for further functionalization. Additionally, this compound may exhibit antioxidant properties and has been studied for its potential effects on cellular processes. As with many organic compounds, safety data should be consulted for handling and usage, as it may pose health risks if not managed properly. Overall, methyl 6-hydroxynicotinate is a versatile compound with significant implications in both research and industrial applications.
Formula:C7H7NO3
InChI:InChI=1/C7H7NO3/c1-11-7(10)5-2-3-6(9)8-4-5/h2-4H,1H3,(H,8,9)
SMILES:COC(=O)c1ccc(nc1)O
Synonyms:- 6-Hydroxynicotinic acid methyl ester
- Methyl 6-Oxo-1,6-Dihydropyridine-3-Carboxylate
- 6-Hydroxy nicotinic acid methyl ester
- 6-Oxo-1,6-Dihydropyridine-3-Carboxylic Acid Methyl Ester
- Methyl 6-Oxo-1,6-Dihydro-3-Pyridinecarboxylate
- methyl 6-oxo-1H-pyridine-3-carboxylate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Methyl 6-hydroxynicotinate
CAS:Methyl 6-hydroxynicotinateFormula:C7H7NO3Purity:97%Molecular weight:153.14Methyl 6-Hydroxynicotinate
CAS:Formula:C7H7NO3Purity:>97.0%(GC)Color and Shape:White to Light yellow powder to crystalMolecular weight:153.14Methyl 6-hydroxynicotinate
CAS:Methyl 6-hydroxynicotinateFormula:C7H7NO3Purity:98%Color and Shape:SolidMolecular weight:153.13538Methyl 6-hydroxynicotinate
CAS:Formula:C7H7NO3Purity:97%Color and Shape:SolidMolecular weight:153.13546-Hydroxy-nicotinic acid methyl ester
CAS:Formula:C7H7NO3Purity:97%Color and Shape:Solid, PowderMolecular weight:153.137




