CymitQuimica logo

CAS 66207-08-7

:

Benzyl 7-oxa-3-azabicyclo[4.1.0]heptane-3-carboxylate

Description:
Benzyl 7-oxa-3-azabicyclo[4.1.0]heptane-3-carboxylate, with the CAS number 66207-08-7, is a bicyclic compound characterized by its unique structural features, including a bicyclo[4.1.0] framework and the presence of an oxo and azabicyclic moiety. This compound typically exhibits properties associated with both its bicyclic structure and functional groups, such as moderate solubility in organic solvents and potential reactivity due to the presence of the carboxylate group. The benzyl group contributes to its hydrophobic character, while the oxo and azabicyclic components may influence its biological activity and interaction with various receptors or enzymes. Such compounds are often of interest in medicinal chemistry for their potential pharmacological properties, including analgesic or anti-inflammatory effects. Additionally, the stereochemistry of the bicyclic structure can play a significant role in determining the compound's biological activity and interactions. Overall, Benzyl 7-oxa-3-azabicyclo[4.1.0]heptane-3-carboxylate represents a complex and intriguing molecule within the realm of organic and medicinal chemistry.
Formula:C13H15NO3
InChI:InChI=1S/C13H15NO3/c15-13(14-7-6-11-12(8-14)17-11)16-9-10-4-2-1-3-5-10/h1-5,11-12H,6-9H2
InChI key:PHSSLYCBJRMEEV-UHFFFAOYSA-N
SMILES:C1CN(CC2C1O2)C(=O)OCC3=CC=CC=C3
Synonyms:
  • 7-Oxa-3-azabicyclo[4.1.0]heptane-3-carboxylic acid, phenylmethyl ester
  • 1-Cbz-3,4-Epoxypiperidine
  • Cis-3-Cbz-7-Oxa-3-Aza-Bicyclo[4.1.0]Heptane
Found 5 products.