CAS 6628-04-2
:4-Amino-2-methylquinoline
Description:
4-Amino-2-methylquinoline is an organic compound characterized by its quinoline structure, which consists of a fused benzene and pyridine ring. This compound features an amino group (-NH2) at the 4-position and a methyl group (-CH3) at the 2-position of the quinoline ring. It is typically a yellow to brown solid, exhibiting moderate solubility in polar solvents such as water and alcohols, while being less soluble in non-polar solvents. The presence of the amino group contributes to its basicity and potential reactivity, allowing it to participate in various chemical reactions, including electrophilic substitutions and coupling reactions. 4-Amino-2-methylquinoline is of interest in various fields, including medicinal chemistry, due to its potential biological activities, such as antimicrobial and antitumor properties. Additionally, it can serve as a building block in the synthesis of more complex organic molecules. Safety data should be consulted, as with any chemical, to understand its handling and toxicity profiles.
Formula:C10H10N2
InChI:InChI=1S/C10H10N2/c1-7-6-9(11)8-4-2-3-5-10(8)12-7/h2-6H,1H3,(H2,11,12)
InChI key:InChIKey=COCFIBRMFPWUDW-UHFFFAOYSA-N
SMILES:NC=1C2=C(N=C(C)C1)C=CC=C2
Synonyms:- (2-Methylquinolin-4-yl)amine
- 2-Methyl-4-aminoquinoline
- 2-Methyl-4-quinolinamine
- 2-Methylquinolin-4-Amine
- 4-Amino-2-Methylquinolinium
- 4-Amino-2-methylquinoline
- 4-Quinaldinamine
- 4-Quinolinamine, 2-methyl-
- NSC 60281
- Quinaldine, 4-amino-
- 4-Aminoquinaldine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 10 products.
4-Amino-2-methylquinoline
CAS:Formula:C10H10N2Purity:>97.0%(GC)(T)Color and Shape:White to Orange to Green powder to crystalMolecular weight:158.202-methylquinolin-4-amine
CAS:Formula:C10H10N2Purity:98%Color and Shape:SolidMolecular weight:158.19984-Aminoquinaldine
CAS:4-AminoquinaldineFormula:C10H10N2Purity:98%Color and Shape:Solid-PowderMolecular weight:158.1998Dequalinium EP Impurity A
CAS:Formula:C10H10N2Color and Shape:White To Off-White SolidMolecular weight:158.204-Aminoquinaldine
CAS:4-Aminoquinaldine is a metastable redox potential compound that has been shown to reversibly reduce the mitochondrial membrane potential in leishmania. It also has been shown to have antimicrobial properties and is able to inhibit the growth of bacteria through hydrogen bonding interactions. 4-Aminoquinaldine is most effective against gram-positive bacteria and has an acidic pH, with a pKa of 3.4. The reaction mechanism for 4-aminoquinaldine involves nucleophilic attack at the C5 position of the quinolinium ring followed by elimination of H2O from the S2 position.Formula:C10H10N2Purity:Min. 99 Area-%Color and Shape:PowderMolecular weight:158.2 g/mol2-Methylquinolin-4-amine
CAS:Formula:C10H10N2Purity:98%Color and Shape:Solid, White to pale yellow powderMolecular weight:158.204








