CAS 6630-13-3
:bis(2-methylphenyl) phosphorochloridate
Description:
Bis(2-methylphenyl) phosphorochloridate, with the CAS number 6630-13-3, is an organophosphorus compound characterized by the presence of a phosphorus atom bonded to two 2-methylphenyl groups and a chloridate group. This compound typically appears as a colorless to pale yellow liquid and is known for its reactivity, particularly due to the presence of the chloridate group, which can participate in nucleophilic substitution reactions. It is often used as a reagent in organic synthesis, particularly in the preparation of phosphonates and phosphoramidates. The compound exhibits moderate toxicity, necessitating careful handling and appropriate safety measures during use. Its chemical structure contributes to its properties, including potential applications in agrochemicals and pharmaceuticals. Additionally, it may undergo hydrolysis in the presence of moisture, leading to the formation of phosphoric acid derivatives. As with many organophosphorus compounds, it is essential to consider environmental and health impacts when working with bis(2-methylphenyl) phosphorochloridate.
Formula:C14H14ClO3P
InChI:InChI=1/C14H14ClO3P/c1-11-7-3-5-9-13(11)17-19(15,16)18-14-10-6-4-8-12(14)2/h3-10H,1-2H3
SMILES:Cc1ccccc1OP(=O)(Cl)Oc1ccccc1C
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
o-Tolyl Phosphorochloridate-d14
CAS:Controlled ProductFormula:C14D14ClO3PColor and Shape:NeatMolecular weight:310.772
