CAS 66322-34-7
:meso-Dihydroguaiaretic acid
Description:
Meso-Dihydroguaiaretic acid, with the CAS number 66322-34-7, is a naturally occurring compound derived from the resin of certain plants, particularly from the guaiacum species. It is characterized by its unique molecular structure, which includes multiple hydroxyl groups, contributing to its solubility in polar solvents. This compound exhibits antioxidant properties, making it of interest in various biological and pharmaceutical applications. Meso-Dihydroguaiaretic acid has been studied for its potential anti-inflammatory and anti-cancer effects, as well as its ability to modulate immune responses. Its stereochemistry is significant, as the "meso" designation indicates the presence of multiple chiral centers that result in an achiral compound. This characteristic can influence its biological activity and interactions with other molecules. Additionally, it is important to note that the compound's stability and reactivity can be affected by environmental factors such as pH and temperature. Overall, meso-Dihydroguaiaretic acid represents a compound of interest in both natural product chemistry and medicinal research.
Formula:C20H26O4
InChI:InChI=1/C20H26O4/c1-13(9-15-5-7-17(21)19(11-15)23-3)14(2)10-16-6-8-18(22)20(12-16)24-4/h5-8,11-14,21-22H,9-10H2,1-4H3/t13-,14+
InChI key:InChIKey=ADFOLUXMYYCTRR-OKILXGFUNA-N
SMILES:C([C@@H]([C@@H](CC1=CC(OC)=C(O)C=C1)C)C)C2=CC(OC)=C(O)C=C2
Synonyms:- Guaiacol, 4,4′-(2,3-dimethyltetramethylene)di-, meso-
- meso-Dihydroguaiaretic acid
- Phenol, 4,4′-(2,3-dimethyl-1,4-butanediyl)bis[2-methoxy-, (R*,S*)-
- rel-4,4′-[(2R,3S)-2,3-Dimethyl-1,4-butanediyl]bis[2-methoxyphenol]
- Phenol, 4,4′-[(2R,3S)-2,3-dimethyl-1,4-butanediyl]bis[2-methoxy-, rel-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 9 products.
meso-Dihydroguaiaretic acid
CAS:meso-Dihydroguaiaretic acid analytical standard provided with chromatographic purity, to be used as reference material for qualitative determination.Formula:C20H26O4Purity:(HPLC) ≥95%Color and Shape:PowderMolecular weight:330.43rel-4,4'-((2R,3S)-2,3-Dimethylbutane-1,4-diyl)bis(2-methoxyphenol)
CAS:rel-4,4'-((2R,3S)-2,3-Dimethylbutane-1,4-diyl)bis(2-methoxyphenol)Formula:C20H26O4Purity:99%Molecular weight:330.42meso-Dihydroguaiaretic acid
CAS:meso-Dihydroguaiaretic acid is a natural lignan exhibiting multiple biological activities, inhibition of proliferation in ACC375, COS, and HeLa cells.Formula:C20H26O4Purity:98.46%Color and Shape:SolidMolecular weight:330.42meso-dihydroguaiaretic acid
CAS:Formula:C20H26O4Purity:95%~99%Color and Shape:PowderMolecular weight:330.424meso-Dihydroguaiaretic acid
CAS:Ether phenolFormula:C20H26O4Purity:≥ 90.0 % (HPLC)Molecular weight:330.42Dihydroguaiaretic Acid
CAS:Controlled ProductFormula:C20H26O4Color and Shape:NeatMolecular weight:330.418Dihydroguaiaretic acid
CAS:Dihydroguaiaretic acid is a naturally occurring lignan, which is derived from various plant sources, particularly coniferous trees and some medicinal plants. Its mode of action involves acting as a potent antioxidant by scavenging free radicals and inhibiting lipid peroxidation. This compound contributes to the stabilization of cellular structures by preventing oxidative damage to lipids, proteins, and nucleic acids.Formula:C20H26O4Purity:Min. 95%Molecular weight:330.42 g/mol








