CymitQuimica logo

CAS 6633-22-3

:

1-(4-Fluorophenyl)-1H-pyrrole-2,5-dione

Description:
1-(4-Fluorophenyl)-1H-pyrrole-2,5-dione, with the CAS number 6633-22-3, is a chemical compound characterized by its unique structure, which includes a pyrrole ring substituted with a fluorophenyl group. This compound typically exhibits a yellow to orange color and is known for its potential applications in organic synthesis and medicinal chemistry. The presence of the fluorine atom enhances its electronic properties, potentially influencing its reactivity and biological activity. As a diketone, it can participate in various chemical reactions, including nucleophilic additions and cycloadditions. The compound's solubility may vary depending on the solvent, and it is generally stable under standard conditions. However, like many organic compounds, it should be handled with care, as it may pose health risks if inhaled or ingested. Its specific properties, such as melting point, boiling point, and spectral characteristics, can be determined through experimental methods and are essential for its application in research and industry.
Formula:C10H6FNO2
InChI:InChI=1/C10H6FNO2/c11-7-1-3-8(4-2-7)12-9(13)5-6-10(12)14/h1-6H
InChI key:SBKKXWSZVVDOLR-UHFFFAOYSA-N
SMILES:c1cc(ccc1F)N1C(=O)C=CC1=O
Synonyms:
  • 1H-Pyrrole-2,5-dione, 1-(4-fluorophenyl)-
Found 4 products.