CAS 66384-66-5
:5-trifluoromethyl-2'-deoxycytidine
Description:
5-Trifluoromethyl-2'-deoxycytidine is a modified nucleoside analog of cytidine, characterized by the presence of a trifluoromethyl group at the 5-position of the pyrimidine ring. This modification enhances its lipophilicity and metabolic stability, making it of interest in medicinal chemistry, particularly in antiviral and anticancer research. The compound retains the essential structural features of nucleosides, including a sugar moiety (deoxyribose) and a nitrogenous base (cytosine), which allows it to participate in nucleic acid synthesis and potentially interfere with normal cellular processes. The trifluoromethyl group can influence the compound's binding affinity to enzymes and receptors, potentially altering its biological activity. Additionally, the presence of fluorine atoms can enhance the compound's resistance to enzymatic degradation. Overall, 5-trifluoromethyl-2'-deoxycytidine represents a valuable tool for studying nucleic acid interactions and developing new therapeutic agents. Its unique properties make it a subject of interest in the fields of biochemistry and pharmacology.
Formula:C10H12F3N3O4
InChI:InChI=1/C10H12F3N3O4/c11-10(12,13)4-2-16(9(19)15-8(4)14)7-1-5(18)6(3-17)20-7/h2,5-7,17-18H,1,3H2,(H2,14,15,19)/t5-,6+,7+/m0/s1
InChI key:XNSPCSMIPDACTB-RRKCRQDMSA-N
SMILES:C1[C@@H]([C@H](O[C@H]1N2C=C(C(=NC2=O)N)C(F)(F)F)CO)O
Synonyms:- 2'-Deoxy-5-(Trifluoromethyl)Cytidine
- 5-(Trifluoromethyl)-2-deoxycytidine
- 5-(Trifluoromethyl)-2'-Deoxycytidine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
2′-Deoxy-5-(trifluoromethyl)cytidine
CAS:Formula:C10H12F3N3O4Purity:95%Color and Shape:SolidMolecular weight:295.21522'-Deoxy-5-(trifluoromethyl)cytidine
CAS:2'-Deoxy-5-(trifluoromethyl)cytidine is a synthetic nucleoside analogue that inhibits the cytidine deaminase enzyme. It is used in the treatment of some types of leukemia and other cancers. The compound, which has a trifluoromethyl group on the 2' position, binds to the active site of cytidine deaminase and prevents it from functioning. This leads to an accumulation of thymidylate, which is required for DNA synthesis. The tumor tissue also contains high concentrations of this drug and its metabolites, making it more effective against cancer cells than normal cells. 2'-Deoxy-5-(trifluoromethyl)cytidine has been shown to inhibit anabolism in tumor tissue in the presence of high concentrations of phosphorylases, which are enzymes that catalyze reactions that break down carbohydrates and proteins into smaller molecules such as glucose or amino acids.Formula:C10H12F3N3O4Purity:Min. 95%Molecular weight:295.22 g/mol



