CymitQuimica logo

CAS 6646-51-1

:

1-Methyl-1H-imidazol-2-amine

Description:
1-Methyl-1H-imidazol-2-amine, with the CAS number 6646-51-1, is an organic compound characterized by its imidazole ring structure, which is a five-membered heterocyclic compound containing two nitrogen atoms. This substance features a methyl group attached to the nitrogen at position one and an amino group at position two, contributing to its basicity and potential reactivity. It is typically a colorless to pale yellow solid or liquid, depending on its purity and form. The compound is soluble in water and polar organic solvents, making it versatile for various applications in organic synthesis and medicinal chemistry. Its properties include being a potential building block for pharmaceuticals and agrochemicals due to its ability to participate in various chemical reactions, such as nucleophilic substitutions and coupling reactions. Additionally, 1-Methyl-1H-imidazol-2-amine may exhibit biological activity, making it of interest in the development of new therapeutic agents. Safety data should be consulted for handling and storage, as with all chemical substances.
Formula:C4H7N3
InChI:InChI=1/C4H7N3/c1-7-3-2-6-4(7)5/h2-3H,1H3,(H2,5,6)
InChI key:NQCJWEXYVVFKBT-UHFFFAOYSA-N
SMILES:Cn1cc[nH]c1=N
Synonyms:
  • 1H-imidazol-2-amine, 1-methyl-
Found 5 products.