CAS 66612-29-1: N-(4-Aminobutyl)-N-ethylisoluminol
Description:N-(4-Aminobutyl)-N-ethylisoluminol, commonly referred to as AEI, is a chemical compound known for its luminescent properties, particularly in chemiluminescence applications. It features a structure that includes an isocyanine backbone, which contributes to its ability to emit light when subjected to certain chemical reactions. This compound is often utilized in biochemical assays and detection methods due to its sensitivity and specificity. AEI is characterized by its solubility in organic solvents, which facilitates its use in various laboratory settings. The presence of the amino group enhances its reactivity, making it suitable for conjugation with other biomolecules. Additionally, AEI's stability under physiological conditions allows for its application in biological systems. Safety considerations should be taken into account when handling this compound, as with many chemical substances, to mitigate any potential hazards. Overall, N-(4-Aminobutyl)-N-ethylisoluminol is a valuable tool in the fields of biochemistry and analytical chemistry, particularly in the development of sensitive detection methods.
Formula:C14H20N4O2
InChI:InChI=1/C14H20N4O2/c1-2-18(8-4-3-7-15)10-5-6-11-12(9-10)14(20)17-16-13(11)19/h5-6,9H,2-4,7-8,15H2,1H3,(H,16,19)(H,17,20)
- Synonyms:
- Abei
- 4-(N-Ethyl-N-aminobutylamino)phthalic hydrazide
- 6-[N-(4-Aminobutyl)-N-ethylamino]-2,3-dihydro-1,4-phthalazinedione
- 6-[(4-Aminobutyl)(Ethyl)Amino]-2,3-Dihydrophthalazine-1,4-Dione
![N-(4-Aminobutyl)-N-ethylisoluminol [Chemiluminescence Reagent]](https://static.cymitquimica.com/products/3B/thumb/A5304.jpg)
