CymitQuimica logo

CAS 6666-75-7

:

methyl 2-cyano-3-methylbut-2-enoate

Description:
Methyl 2-cyano-3-methylbut-2-enoate, with the CAS number 6666-75-7, is an organic compound characterized by its functional groups, including a cyano group (-CN) and an ester group (-COO-). It features a methyl group attached to a butenoate backbone, which contributes to its reactivity and potential applications in organic synthesis. This compound typically appears as a colorless to pale yellow liquid with a distinctive odor. It is soluble in organic solvents, such as ethanol and acetone, but has limited solubility in water due to its hydrophobic nature. Methyl 2-cyano-3-methylbut-2-enoate is often used as an intermediate in the synthesis of various pharmaceuticals and agrochemicals, owing to its ability to participate in nucleophilic addition reactions. Additionally, its cyano group can facilitate further chemical transformations, making it a valuable building block in synthetic organic chemistry. Safety precautions should be taken when handling this compound, as it may pose health risks if inhaled or ingested.
Formula:C7H9NO2
InChI:InChI=1/C7H9NO2/c1-5(2)6(4-8)7(9)10-3/h1-3H3
InChI key:UQJYFFMPKAPLJX-UHFFFAOYSA-N
SMILES:CC(=C(C#N)C(=O)OC)C
Found 4 products.