CymitQuimica logo

CAS 66739-89-7

:

4-(1,3-dioxolan-2-yl)benzonitrile

Description:
4-(1,3-Dioxolan-2-yl)benzonitrile, with the CAS number 66739-89-7, is an organic compound characterized by its unique structure that includes a benzonitrile moiety and a dioxolane ring. The presence of the dioxolane ring contributes to its potential as a solvent or intermediate in organic synthesis. This compound typically exhibits moderate polarity due to the nitrile group, which can engage in hydrogen bonding and dipole interactions. It is generally soluble in organic solvents such as ethanol and acetone, while its solubility in water is limited. The compound may be used in various applications, including pharmaceuticals and agrochemicals, owing to its functional groups that can participate in further chemical reactions. Additionally, its stability under standard conditions makes it a suitable candidate for various synthetic pathways. Safety data should be consulted for handling, as with any chemical substance, to ensure proper precautions are taken during use.
Formula:C10H9NO2
InChI:InChI=1/C10H9NO2/c11-7-8-1-3-9(4-2-8)10-12-5-6-13-10/h1-4,10H,5-6H2
InChI key:AQXQCWAXQJVTKU-UHFFFAOYSA-N
SMILES:c1cc(ccc1C#N)C1OCCO1
Found 4 products.