CAS 667412-89-7

3-methoxy-2-[(3-methoxybenzyl)oxy]benzaldehyde

Description:

3-Methoxy-2-[(3-methoxybenzyl)oxy]benzaldehyde, with the CAS number 667412-89-7, is an organic compound characterized by its aromatic structure, which includes a benzaldehyde functional group and methoxy substituents. This compound features a methoxy group (-OCH3) attached to both the benzaldehyde and a benzyl ether moiety, contributing to its overall hydrophobic character. The presence of multiple methoxy groups enhances its solubility in organic solvents and may influence its reactivity and interaction with biological systems. As an aromatic aldehyde, it can participate in various chemical reactions, including nucleophilic additions and condensation reactions. The compound may exhibit interesting biological activities, making it a subject of interest in medicinal chemistry and organic synthesis. Its structural features suggest potential applications in the development of pharmaceuticals or as a building block in organic synthesis. However, specific properties such as melting point, boiling point, and spectral data would require empirical measurement or literature reference for precise characterization.

Formula: C₁₆H₁₆O₄

InChI: InChI=1/C16H16O4/c1-18-14-7-3-5-12(9-14)11-20-16-13(10-17)6-4-8-15(16)19-2/h3-10H,11H2,1-2H3

SMILES: COc1cccc(c1)COc1c(cccc1OC)C=O

Synonyms:

• Benzaldehyde, 3-Methoxy-2-[(3-Methoxyphenyl)Methoxy]-

3-methoxy-2-[(3-methoxybenzyl)oxy]benzaldehyde

CAS: 667412-89-7

Formula: C₁₆H₁₆O₄

Purity: 95%

Molecular weight: 272.3

Ref: 10-F307561