CAS 667413-00-5

2-(2,4-Difluorophenoxy)-2-methylpropanoic acid

Description:

2-(2,4-Difluorophenoxy)-2-methylpropanoic acid, identified by its CAS number 667413-00-5, is a chemical compound characterized by its unique structure, which includes a difluorophenoxy group attached to a branched propanoic acid moiety. This compound typically exhibits properties associated with both aromatic and aliphatic functionalities, contributing to its potential applications in various fields, including pharmaceuticals and agrochemicals. The presence of fluorine atoms in the aromatic ring can enhance lipophilicity and metabolic stability, making it an interesting candidate for drug development. Additionally, the carboxylic acid functional group imparts acidic properties, allowing for potential interactions in biological systems. The compound's solubility, reactivity, and stability can be influenced by the presence of the difluorophenyl group and the branched alkyl chain. Overall, 2-(2,4-Difluorophenoxy)-2-methylpropanoic acid represents a versatile structure with potential implications in medicinal chemistry and material science.

Formula: C₁₀H₁₀F₂O₃

InChI: InChI=1S/C10H10F2O3/c1-10(2,9(13)14)15-8-4-3-6(11)5-7(8)12/h3-5H,1-2H3,(H,13,14)

InChI key: InChIKey=LUUNNYIKQOANCC-UHFFFAOYSA-N

SMILES: O(C(C(O)=O)(C)C)C1=C(F)C=C(F)C=C1

Synonyms:

• 2-(2,4-Difluoro-phenoxy)-2-methyl-propionic acid
• Propanoic Acid, 2-(2,4-Difluorophenoxy)-2-Methyl-
• 2-(2,4-Difluorophenoxy)-2-methylpropanoic acid

AKOS B013914

CAS: 667413-00-5

Formula: C₁₀H₁₀F₂O₃

Purity: 97%

Color and Shape: Solid

Molecular weight: 216.1814

Ref: IN-DA00FBTH

2-(2,4-Difluorophenoxy)-2-methylpropanoic acid

CAS: 667413-00-5

2-(2,4-Difluorophenoxy)-2-methylpropanoic acid

Formula: C₁₀H₁₀F₂O₃

Purity: 95%

Molecular weight: 216.18

Ref: 54-PC1021780

2-(2,4-Difluorophenoxy)-2-methylpropanoic acid

CAS: 667413-00-5

2-(2,4-Difluorophenoxy)-2-methylpropanoic acid is a versatile building block that can be used in research and development of complex compounds. It has CAS No. 667413-00-5 and is classified as a fine chemical. 2-(2,4-Difluorophenoxy)-2-methylpropanoic acid can be used in the synthesis of useful scaffolds and reaction components. It is also a reagent for use in the synthesis of speciality chemicals. This compound has high quality and is an important intermediate for the production of other compounds.

Formula: C₁₀H₁₀F₂O₃

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 216.18 g/mol

Ref: 3D-FD90024

2-(2,4-difluorophenoxy)-2-methylpropanoic acid

CAS: 667413-00-5

Formula: C₁₀H₁₀F₂O₃

Purity: 97%

Molecular weight: 216.184

Ref: 10-F307520