
CAS 66939-00-2
:Methyl [5-(2-Fluorobenzoyl)-1H-benz
Description:
Methyl [5-(2-Fluorobenzoyl)-1H-benz] is a chemical compound characterized by its specific molecular structure, which includes a methyl group and a benzoyl moiety substituted with a fluorine atom. The presence of the fluorine atom typically enhances the compound's lipophilicity and may influence its reactivity and biological activity. This compound is likely to exhibit properties common to aromatic compounds, such as stability and potential for π-π stacking interactions. The benzoyl group can participate in various chemical reactions, including acylation and electrophilic substitution. Additionally, the compound may have applications in pharmaceuticals or materials science, given the functional groups present. Its CAS number, 66939-00-2, allows for easy identification in chemical databases, facilitating research and development. As with many organic compounds, safety data sheets should be consulted for handling and toxicity information, as the presence of fluorine can sometimes indicate specific hazards. Overall, Methyl [5-(2-Fluorobenzoyl)-1H-benz] represents a unique structure with potential utility in various chemical applications.
Formula:C16H12FN3O3
InChI:InChI=1S/C16H12FN3O3/c1-23-16(22)20-15-18-12-7-6-9(8-13(12)19-15)14(21)10-4-2-3-5-11(10)17/h2-8H,1H3,(H2,18,19,20,22)
InChI key:QTHXIRKBRCLTPI-UHFFFAOYSA-N
SMILES:COC(=O)NC1=NC2=C(N1)C=C(C=C2)C(=O)C3=CC=CC=C3F
Synonyms:- Methyl [5-(2-Fluorobenzoyl)-1H-benzimidazol-2-yl]carbamate
- Methyl [5-(2-Fluorobenzoyl)-1H-benz
- Flubendazole Impurity 4
- Flubendazole Impurity E
- Carbamic acid, [5-(2-fluorobenzoyl)-1H-benzimidazol-2-yl]-, methyl ester (9CI)
- Flubendazole Impurity 11 (Flubendazole EP Impurity E)
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery


