CymitQuimica logo

CAS 66990-30-5

:

10,12-Tricosadiynoic acid

Description:
10,12-Tricosadiynoic acid is a long-chain fatty acid characterized by its unique structure, which includes two conjugated triple bonds located at the 10th and 12th carbon positions of the carbon chain. This compound belongs to the class of diacetylenic fatty acids and is notable for its potential applications in materials science and biochemistry due to its ability to form organized structures. It is typically a solid at room temperature and exhibits a high melting point, which is common for long-chain fatty acids. The presence of the triple bonds contributes to its reactivity, making it a candidate for polymerization and other chemical transformations. Additionally, 10,12-Tricosadiynoic acid can participate in various biochemical processes and may have implications in the study of lipid membranes and drug delivery systems. Its unique properties make it a subject of interest in research related to synthetic biology and nanotechnology. Safety and handling precautions should be observed, as with any chemical substance, due to potential hazards associated with its reactivity.
Formula:C23H38O2
InChI:InChI=1/C23H38O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23(24)25/h2-10,15-22H2,1H3,(H,24,25)
InChI key:DIEDVCMBPCRJFQ-UHFFFAOYSA-N
SMILES:CCCCCCCCCCC#CC#CCCCCCCCCC(=O)O
Synonyms:
  • Tricosa-10,12-Diynoic Acid
  • TIMTEC-BB SBB009036
  • 10,12-TRICOSADIYNOIC ACID
Found 7 products.