CymitQuimica logo

CAS 670256-21-0

:

Benzoicacid, 4-bromo-2-(hydroxymethyl)-

Description:
Benzoic acid, 4-bromo-2-(hydroxymethyl)-, is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with a bromine atom and a hydroxymethyl group. This compound features a carboxylic acid functional group, contributing to its acidic properties. The presence of the bromine atom typically enhances the compound's reactivity and can influence its biological activity, while the hydroxymethyl group may provide sites for further chemical modifications. The molecular structure suggests potential applications in pharmaceuticals, agrochemicals, or as intermediates in organic synthesis. Additionally, the compound's solubility and stability can be affected by the substituents on the benzene ring, which may also influence its interactions in various chemical environments. Overall, 4-bromo-2-(hydroxymethyl)benzoic acid is a versatile compound with potential utility in various chemical and industrial applications.
Formula:C8H7BrO3
InChI:InChI=1S/C8H7BrO3/c9-6-1-2-7(8(11)12)5(3-6)4-10/h1-3,10H,4H2,(H,11,12)
InChI key:YNXAGQITFDILGX-UHFFFAOYSA-N
SMILES:C1=CC(=C(C=C1Br)CO)C(=O)O
Synonyms:
  • o-Toluicacid, 4-bromo-a-hydroxy- (5CI)
  • 4-Bromo-2-(hydroxymethyl)benzoic acid
Found 4 products.