CymitQuimica logo

CAS 671-01-2

:

Benzamide, 3-fluoro-N-(phenylmethyl)-

Description:
Benzamide, 3-fluoro-N-(phenylmethyl)-, with the CAS number 671-01-2, is an organic compound characterized by its amide functional group, which is derived from benzoic acid. This compound features a fluorine atom positioned at the meta position relative to the amide group on the benzene ring, contributing to its unique chemical properties. The presence of the phenylmethyl group (benzyl group) enhances its lipophilicity, potentially influencing its solubility and reactivity. Benzamide derivatives are often studied for their biological activities, including potential pharmaceutical applications, due to their ability to interact with various biological targets. The fluorine substituent can also affect the compound's electronic properties, making it of interest in medicinal chemistry. In terms of physical properties, benzamides typically exhibit moderate melting and boiling points, and their behavior in chemical reactions can be influenced by the presence of the fluorine atom. Overall, this compound exemplifies the diverse chemistry of substituted amides and their relevance in both synthetic and medicinal chemistry contexts.
Formula:C14H12FNO
InChI:InChI=1S/C14H12FNO/c15-13-8-4-7-12(9-13)14(17)16-10-11-5-2-1-3-6-11/h1-9H,10H2,(H,16,17)
InChI key:LKIBJWJYXBXEEB-UHFFFAOYSA-N
SMILES:C1=CC=C(C=C1)CNC(=O)C2=CC(=CC=C2)F
Found 3 products.