CAS 671-04-5: Carbanolate
Description:Carbanolate, with the CAS number 671-04-5, is a chemical compound that belongs to the class of carbanions, specifically characterized by the presence of a negatively charged carbon atom bonded to an oxygen atom. This compound typically exhibits properties associated with its anionic nature, such as high reactivity and the ability to act as a nucleophile in various chemical reactions. Carbanolates are often involved in organic synthesis, particularly in the formation of carbon-carbon bonds through nucleophilic substitution reactions. They can also participate in deprotonation reactions, making them useful in the synthesis of more complex organic molecules. The stability and reactivity of carbanolates can be influenced by the surrounding functional groups and the overall molecular structure. Additionally, carbanolates may exhibit solubility in polar solvents, which can facilitate their use in various chemical processes. Understanding the characteristics of carbanolate is essential for its application in synthetic organic chemistry and related fields.
Formula:C10H12ClNO2
InChI:InChI=1S/C10H12ClNO2/c1-6-4-8(11)9(5-7(6)2)14-10(13)12-3/h4-5H,1-3H3,(H,12,13)
InChI key:InChIKey=QRTXZGIQTYDABO-UHFFFAOYSA-N
SMILES:O=C(OC=1C=C(C(=CC1Cl)C)C)NC
- Synonyms:
- 2-Chloro-4,5-Dimethylphenyl Methylcarbamate
- 2-Chloro-4,5-dimethylphenyl N-methylcarbamate
- 3,4-Dimethyl-6-chlorophenyl N-methylcarbamate
- 3,4-Xylyl-6-chloro-N-methylcarbamate
- 6-Chloro-3,4-Xylyl Methylcarbamate
- 6-Chloro-3,4-dimethylphenyl N-methylcarbamate
- Banol
- Carbamic acid, methyl-, 6-chloro-3,4-xylyl ester
- Phenol, 2-chloro-4,5-dimethyl-, 1-(N-methylcarbamate)
- Phenol, 2-chloro-4,5-dimethyl-, methylcarbamate
- See more synonyms
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | HJ 827-2017 Carbamate Pesticides Mixture 520 50-1000 µg/mL in Methanol REF: 04-A50000520MECAS: | - - - | To inquire | Wed 07 May 25 |
![]() | Carbanolate 10 µg/mL in Cyclohexane REF: 04-L10970000CYCAS: 671-04-5 | - - - | To inquire | Wed 07 May 25 |
![]() | 2-Chloro-4,5-dimethylphenyl methylcarbamate REF: 3D-AAA67104CAS: 671-04-5 | Min. 95% | - - - | Discontinued product |

HJ 827-2017 Carbamate Pesticides Mixture 520 50-1000 µg/mL in Methanol
Controlled ProductRef: 04-A50000520ME
1ml | To inquire |

Carbanolate 10 µg/mL in Cyclohexane
Ref: 04-L10970000CY
10ml | To inquire |

2-Chloro-4,5-dimethylphenyl methylcarbamate
Ref: 3D-AAA67104
5mg | Discontinued | Request information | |
10mg | Discontinued | Request information | |
25mg | Discontinued | Request information | |
50mg | Discontinued | Request information |