CAS 672-30-0
:1-bromo-3-(pentafluoro-lambda~6~-sulfanyl)benzene
Description:
1-Bromo-3-(pentafluoro-lambda^6-sulfanyl)benzene, with the CAS number 672-30-0, is an organofluorine compound characterized by the presence of both bromine and a pentafluorosulfanyl group attached to a benzene ring. The bromine atom is located at the 1-position, while the pentafluorosulfanyl group is positioned at the 3-position of the aromatic ring, contributing to its unique chemical properties. This compound is notable for its high fluorine content, which imparts significant electronegativity and alters its reactivity compared to non-fluorinated analogs. The presence of the pentafluorosulfanyl group enhances its potential applications in various fields, including materials science and pharmaceuticals, due to the stability and unique electronic properties associated with fluorinated compounds. Additionally, the compound's structure suggests potential for interesting interactions in chemical reactions, particularly in nucleophilic substitution and electrophilic aromatic substitution processes. Overall, 1-bromo-3-(pentafluoro-lambda^6-sulfanyl)benzene exemplifies the intriguing chemistry of fluorinated aromatic compounds.
Formula:C6H4BrF5S
InChI:InChI=1/C6H4BrF5S/c7-5-2-1-3-6(4-5)13(8,9,10,11)12/h1-4H
SMILES:c1cc(cc(c1)S(F)(F)(F)(F)F)Br
Synonyms:- 3-Bromophenylsulfur pentafluoride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
3-Bromophenylsulfur Pentafluoride
CAS:Formula:C6H4BrF5SPurity:>92.0%(GC)Color and Shape:Colorless to Light yellow to Red clear liquidMolecular weight:283.053-Bromophenylsulphur pentafluoride
CAS:3-Bromophenylsulphur pentafluorideFormula:C6H4BrF5SPurity:95%Color and Shape:Colourless LiquidMolecular weight:283.05697(3-Bromophenyl)sulfur pentafluoride
CAS:Formula:C6H4BrF5SPurity:98%Color and Shape:LiquidMolecular weight:283.05703-Bromophenylsulfur pentafluoride
CAS:Formula:C6H4BrF5SPurity:97%Color and Shape:LiquidMolecular weight:283.051-Bromo-3-(Pentafluorosulfanyl)Benzene
CAS:1-Bromo-3-(pentafluorosulfanyl)benzene is a molecule that can be used in the synthesis of biologically active compounds. It has been shown to have anti-inflammatory properties, which may be due to its ability to modulate the activity of 5-hydroxytryptamine (5-HT). The functionalities of 1-bromo-3-(pentafluorosulfanyl)benzene include cross-coupling (i.e., chemical reactions that join two or more substances together), protonation, and ligand binding. This molecule has been synthesized from 2,4,6-trifluorobenzonitrile and bromine. The isomers for this molecule are cis and trans, with the cis isomer being more active than the trans isomer. Techniques such as molecular modeling have also been used to study 1-bromo-3-(pentafluorosulfanyl)benFormula:C6H4BrF5SPurity:Min. 95%Molecular weight:283.06 g/mol




